C10H7ClF3N5O2 — CID 79826988
4-[5-chloro-4-nitro-3-(trifluoromethyl)pyrazol-1-yl]-2,6-dimethylpyrimidine (PubChem CID 79826988) has the molecular formula C10H7ClF3N5O2 and a molecular weight of 321.65 g/mol. Its IUPAC name is 4-[5-chloro-4-nitro-3-(trifluoromethyl)pyrazol-1-yl]-2,6-dimethylpyrimidine.
| Compound Name | 4-[5-chloro-4-nitro-3-(trifluoromethyl)pyrazol-1-yl]-2,6-dimethylpyrimidine |
|---|---|
| PubChem CID | 79826988 |
| Molecular Formula | C10H7ClF3N5O2 |
| Molecular Weight | 321.65 g/mol |
| Exact Mass | 321.02 |
| IUPAC Name | 4-[5-chloro-4-nitro-3-(trifluoromethyl)pyrazol-1-yl]-2,6-dimethylpyrimidine |
| SMILES | Cc1cc(-n2nc(C(F)(F)F)c([N+](=O)[O-])c2Cl)nc(C)n1 |
| InChI | InChI=1S/C10H7ClF3N5O2/c1-4-3-6(16-5(2)15-4)18-9(11)7(19(20)21)8(17-18)10(12,13)14/h3H,1-2H3 |
| InChIKey | ZVVWTHKYJIEGKZ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.65 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|