C19H26N2O6S — CID 7982703
(2-morpholin-4-yl-2-oxoethyl) (2S)-2-[(2-methoxybenzoyl)amino]-4-methylsulfanylbutanoate (PubChem CID 7982703) has the molecular formula C19H26N2O6S and a molecular weight of 410.49 g/mol. Its IUPAC name is (2-morpholin-4-yl-2-oxoethyl) (2S)-2-[(2-methoxybenzoyl)amino]-4-methylsulfanylbutanoate.
| Compound Name | (2-morpholin-4-yl-2-oxoethyl) (2S)-2-[(2-methoxybenzoyl)amino]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 7982703 |
| Molecular Formula | C19H26N2O6S |
| Molecular Weight | 410.49 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | (2-morpholin-4-yl-2-oxoethyl) (2S)-2-[(2-methoxybenzoyl)amino]-4-methylsulfanylbutanoate |
| SMILES | COc1ccccc1C(=O)N[C@@H](CCSC)C(=O)OCC(=O)N1CCOCC1 |
| InChI | InChI=1S/C19H26N2O6S/c1-25-16-6-4-3-5-14(16)18(23)20-15(7-12-28-2)19(24)27-13-17(22)21-8-10-26-11-9-21/h3-6,15H,7-13H2,1-2H3,(H,20,23)/t15-/m0/s1 |
| InChIKey | OTGMNXBQSCCCFO-HNNXBMFYSA-N |
| XLogP | 0.95 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.49 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |