C11H20N4 — CID 79828067
6-N-methyl-6-N-pentan-3-ylpyridine-2,3,6-triamine (PubChem CID 79828067) has the molecular formula C11H20N4 and a molecular weight of 208.31 g/mol. Its IUPAC name is 6-N-methyl-6-N-pentan-3-ylpyridine-2,3,6-triamine.
| Compound Name | 6-N-methyl-6-N-pentan-3-ylpyridine-2,3,6-triamine |
|---|---|
| PubChem CID | 79828067 |
| Molecular Formula | C11H20N4 |
| Molecular Weight | 208.31 g/mol |
| Exact Mass | 208.17 |
| IUPAC Name | 6-N-methyl-6-N-pentan-3-ylpyridine-2,3,6-triamine |
| SMILES | CCC(CC)N(C)c1ccc(N)c(N)n1 |
| InChI | InChI=1S/C11H20N4/c1-4-8(5-2)15(3)10-7-6-9(12)11(13)14-10/h6-8H,4-5,12H2,1-3H3,(H2,13,14) |
| InChIKey | HQUJYMWMQQIESK-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.31 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |