C12H10ClN3O4 — CID 79831310
3-chloro-N-[(5-methyl-1,2-oxazol-3-yl)methyl]-2-nitrobenzamide (PubChem CID 79831310) has the molecular formula C12H10ClN3O4 and a molecular weight of 295.68 g/mol. Its IUPAC name is 3-chloro-N-[(5-methyl-1,2-oxazol-3-yl)methyl]-2-nitrobenzamide.
| Compound Name | 3-chloro-N-[(5-methyl-1,2-oxazol-3-yl)methyl]-2-nitrobenzamide |
|---|---|
| PubChem CID | 79831310 |
| Molecular Formula | C12H10ClN3O4 |
| Molecular Weight | 295.68 g/mol |
| Exact Mass | 295.04 |
| IUPAC Name | 3-chloro-N-[(5-methyl-1,2-oxazol-3-yl)methyl]-2-nitrobenzamide |
| SMILES | Cc1cc(CNC(=O)c2cccc(Cl)c2[N+](=O)[O-])no1 |
| InChI | InChI=1S/C12H10ClN3O4/c1-7-5-8(15-20-7)6-14-12(17)9-3-2-4-10(13)11(9)16(18)19/h2-5H,6H2,1H3,(H,14,17) |
| InChIKey | YVRSJVRNYKRFPL-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 98.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.68 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|