C11H8ClN3O4 — CID 79833326
3-chloro-2-nitro-N-(1,2-oxazol-3-ylmethyl)benzamide (PubChem CID 79833326) has the molecular formula C11H8ClN3O4 and a molecular weight of 281.65 g/mol. Its IUPAC name is 3-chloro-2-nitro-N-(1,2-oxazol-3-ylmethyl)benzamide.
| Compound Name | 3-chloro-2-nitro-N-(1,2-oxazol-3-ylmethyl)benzamide |
|---|---|
| PubChem CID | 79833326 |
| Molecular Formula | C11H8ClN3O4 |
| Molecular Weight | 281.65 g/mol |
| Exact Mass | 281.02 |
| IUPAC Name | 3-chloro-2-nitro-N-(1,2-oxazol-3-ylmethyl)benzamide |
| SMILES | O=C(NCc1ccon1)c1cccc(Cl)c1[N+](=O)[O-] |
| InChI | InChI=1S/C11H8ClN3O4/c12-9-3-1-2-8(10(9)15(17)18)11(16)13-6-7-4-5-19-14-7/h1-5H,6H2,(H,13,16) |
| InChIKey | VVHYLDOOWLCLDO-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 98.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.65 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|