C10H11ClN4 — CID 79839401
3-chloro-N-[(5-methyl-1H-pyrazol-4-yl)methyl]pyridin-4-amine (PubChem CID 79839401) has the molecular formula C10H11ClN4 and a molecular weight of 222.68 g/mol. Its IUPAC name is 3-chloro-N-[(5-methyl-1H-pyrazol-4-yl)methyl]pyridin-4-amine.
| Compound Name | 3-chloro-N-[(5-methyl-1H-pyrazol-4-yl)methyl]pyridin-4-amine |
|---|---|
| PubChem CID | 79839401 |
| Molecular Formula | C10H11ClN4 |
| Molecular Weight | 222.68 g/mol |
| Exact Mass | 222.07 |
| IUPAC Name | 3-chloro-N-[(5-methyl-1H-pyrazol-4-yl)methyl]pyridin-4-amine |
| SMILES | Cc1[nH]ncc1CNc1ccncc1Cl |
| InChI | InChI=1S/C10H11ClN4/c1-7-8(5-14-15-7)4-13-10-2-3-12-6-9(10)11/h2-3,5-6H,4H2,1H3,(H,12,13)(H,14,15) |
| InChIKey | QRPAMURPADCCDM-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.68 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |