C20H17N3O4S — CID 7983972
[2-(2-methyl-4-thiocyanatoanilino)-2-oxoethyl] (2R)-2-(4-cyanophenoxy)propanoate (PubChem CID 7983972) has the molecular formula C20H17N3O4S and a molecular weight of 395.44 g/mol. Its IUPAC name is [2-(2-methyl-4-thiocyanatoanilino)-2-oxoethyl] (2R)-2-(4-cyanophenoxy)propanoate.
| Compound Name | [2-(2-methyl-4-thiocyanatoanilino)-2-oxoethyl] (2R)-2-(4-cyanophenoxy)propanoate |
|---|---|
| PubChem CID | 7983972 |
| Molecular Formula | C20H17N3O4S |
| Molecular Weight | 395.44 g/mol |
| Exact Mass | 395.09 |
| IUPAC Name | [2-(2-methyl-4-thiocyanatoanilino)-2-oxoethyl] (2R)-2-(4-cyanophenoxy)propanoate |
| SMILES | Cc1cc(SC#N)ccc1NC(=O)COC(=O)[C@@H](C)Oc1ccc(C#N)cc1 |
| InChI | InChI=1S/C20H17N3O4S/c1-13-9-17(28-12-22)7-8-18(13)23-19(24)11-26-20(25)14(2)27-16-5-3-15(10-21)4-6-16/h3-9,14H,11H2,1-2H3,(H,23,24)/t14-/m1/s1 |
| InChIKey | GSDFBFNHIUXOAL-CQSZACIVSA-N |
| XLogP | 3.39 |
| TPSA | 112.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.44 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|