C20H20N4O4S — CID 8887599
[2-(2-methyl-4-thiocyanatoanilino)-2-oxoethyl] (2S)-2-(phenylcarbamoylamino)propanoate (PubChem CID 8887599) has the molecular formula C20H20N4O4S and a molecular weight of 412.47 g/mol. Its IUPAC name is [2-(2-methyl-4-thiocyanatoanilino)-2-oxoethyl] (2S)-2-(phenylcarbamoylamino)propanoate.
| Compound Name | [2-(2-methyl-4-thiocyanatoanilino)-2-oxoethyl] (2S)-2-(phenylcarbamoylamino)propanoate |
|---|---|
| PubChem CID | 8887599 |
| Molecular Formula | C20H20N4O4S |
| Molecular Weight | 412.47 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | [2-(2-methyl-4-thiocyanatoanilino)-2-oxoethyl] (2S)-2-(phenylcarbamoylamino)propanoate |
| SMILES | Cc1cc(SC#N)ccc1NC(=O)COC(=O)[C@H](C)NC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C20H20N4O4S/c1-13-10-16(29-12-21)8-9-17(13)24-18(25)11-28-19(26)14(2)22-20(27)23-15-6-4-3-5-7-15/h3-10,14H,11H2,1-2H3,(H,24,25)(H2,22,23,27)/t14-/m0/s1 |
| InChIKey | SSFDSLKOCPXZAJ-AWEZNQCLSA-N |
| XLogP | 3.26 |
| TPSA | 120.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.47 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|