C11H14ClN3 — CID 79841476
3-[(3-chloro-4-pyridinyl)-ethylamino]-2-methylpropanenitrile (PubChem CID 79841476) has the molecular formula C11H14ClN3 and a molecular weight of 223.71 g/mol. Its IUPAC name is 3-[(3-chloro-4-pyridinyl)-ethylamino]-2-methylpropanenitrile.
| Compound Name | 3-[(3-chloro-4-pyridinyl)-ethylamino]-2-methylpropanenitrile |
|---|---|
| PubChem CID | 79841476 |
| Molecular Formula | C11H14ClN3 |
| Molecular Weight | 223.71 g/mol |
| Exact Mass | 223.09 |
| IUPAC Name | 3-[(3-chloro-4-pyridinyl)-ethylamino]-2-methylpropanenitrile |
| SMILES | CCN(CC(C)C#N)c1ccncc1Cl |
| InChI | InChI=1S/C11H14ClN3/c1-3-15(8-9(2)6-13)11-4-5-14-7-10(11)12/h4-5,7,9H,3,8H2,1-2H3 |
| InChIKey | KJOVUBPONXHRGR-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 39.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.71 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |