C10H18N2O4 — CID 79846049
2-[1-[[2-(2-aminoethoxy)acetyl]amino]cyclobutyl]acetic acid (PubChem CID 79846049) has the molecular formula C10H18N2O4 and a molecular weight of 230.26 g/mol. Its IUPAC name is 2-[1-[[2-(2-aminoethoxy)acetyl]amino]cyclobutyl]acetic acid.
| Compound Name | 2-[1-[[2-(2-aminoethoxy)acetyl]amino]cyclobutyl]acetic acid |
|---|---|
| PubChem CID | 79846049 |
| Molecular Formula | C10H18N2O4 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | 2-[1-[[2-(2-aminoethoxy)acetyl]amino]cyclobutyl]acetic acid |
| SMILES | NCCOCC(=O)NC1(CC(=O)O)CCC1 |
| InChI | InChI=1S/C10H18N2O4/c11-4-5-16-7-8(13)12-10(2-1-3-10)6-9(14)15/h1-7,11H2,(H,12,13)(H,14,15) |
| InChIKey | IZFQCRRHYLSQNS-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|