About 3-[(2,2-dimethylcyclopentyl)amino]cyclobutan-1-ol
3-[(2,2-dimethylcyclopentyl)amino]cyclobutan-1-ol (PubChem CID 79856418) has the molecular formula C11H21NO
and a molecular weight of 183.29 g/mol. Its IUPAC name is 3-[(2,2-dimethylcyclopentyl)amino]cyclobutan-1-ol.
Molecular Properties
| Compound Name | 3-[(2,2-dimethylcyclopentyl)amino]cyclobutan-1-ol |
| PubChem CID | 79856418 |
| Molecular Formula | C11H21NO |
| Molecular Weight | 183.29 g/mol |
| Exact Mass | 183.16 |
| IUPAC Name | 3-[(2,2-dimethylcyclopentyl)amino]cyclobutan-1-ol |
| SMILES | CC1(C)CCCC1NC1CC(O)C1 |
| InChI | InChI=1S/C11H21NO/c1-11(2)5-3-4-10(11)12-8-6-9(13)7-8/h8-10,12-13H,3-7H2,1-2H3 |
| InChIKey | VIIOPNVVFQPABR-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.29 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[(2,2-dimethylcyclopentyl)amino]cyclobutan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2,2-dimethylcyclopentyl)amino]cyclobutan-1-ol?
The IUPAC name of 3-[(2,2-dimethylcyclopentyl)amino]cyclobutan-1-ol (CID 79856418) is 3-[(2,2-dimethylcyclopentyl)amino]cyclobutan-1-ol.
What is the SMILES notation for 3-[(2,2-dimethylcyclopentyl)amino]cyclobutan-1-ol?
The canonical SMILES for 3-[(2,2-dimethylcyclopentyl)amino]cyclobutan-1-ol is CC1(C)CCCC1NC1CC(O)C1.
What is the InChIKey of 3-[(2,2-dimethylcyclopentyl)amino]cyclobutan-1-ol?
The InChIKey is VIIOPNVVFQPABR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NO/c1-11(2)5-3-4-10(11)12-8-6-9(13)7-8/h8-10,12-13H,3-7H2,1-2H3.
What are the key properties of 3-[(2,2-dimethylcyclopentyl)amino]cyclobutan-1-ol?
3-[(2,2-dimethylcyclopentyl)amino]cyclobutan-1-ol has a molecular weight of 183.29 g/mol, XLogP of 1.68, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2,2-dimethylcyclopentyl)amino]cyclobutan-1-ol is sourced from PubChem (CID 79856418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).