C12H24N2 — CID 79860987
N-(2,2-dimethylcyclopentyl)piperidin-3-amine (PubChem CID 79860987) has the molecular formula C12H24N2 and a molecular weight of 196.34 g/mol. Its IUPAC name is N-(2,2-dimethylcyclopentyl)piperidin-3-amine.
| Compound Name | N-(2,2-dimethylcyclopentyl)piperidin-3-amine |
|---|---|
| PubChem CID | 79860987 |
| Molecular Formula | C12H24N2 |
| Molecular Weight | 196.34 g/mol |
| Exact Mass | 196.19 |
| IUPAC Name | N-(2,2-dimethylcyclopentyl)piperidin-3-amine |
| SMILES | CC1(C)CCCC1NC1CCCNC1 |
| InChI | InChI=1S/C12H24N2/c1-12(2)7-3-6-11(12)14-10-5-4-8-13-9-10/h10-11,13-14H,3-9H2,1-2H3 |
| InChIKey | QCSRGGULGOPCRX-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.34 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |