C9H13FO2 — CID 79856610
2-(2,2-dimethylcyclopentylidene)-2-fluoroacetic acid (PubChem CID 79856610) has the molecular formula C9H13FO2 and a molecular weight of 172.20 g/mol. Its IUPAC name is 2-(2,2-dimethylcyclopentylidene)-2-fluoroacetic acid.
| Compound Name | 2-(2,2-dimethylcyclopentylidene)-2-fluoroacetic acid |
|---|---|
| PubChem CID | 79856610 |
| Molecular Formula | C9H13FO2 |
| Molecular Weight | 172.20 g/mol |
| Exact Mass | 172.09 |
| IUPAC Name | 2-(2,2-dimethylcyclopentylidene)-2-fluoroacetic acid |
| SMILES | CC1(C)CCCC1=C(F)C(=O)O |
| InChI | InChI=1S/C9H13FO2/c1-9(2)5-3-4-6(9)7(10)8(11)12/h3-5H2,1-2H3,(H,11,12) |
| InChIKey | YITKVPRTLBFCEL-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.20 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|