2-(2,2-dimethylcyclopentylidene)-2-fluoroacetic acid

C9H13FO2 — CID 79856610

IUPAC2-(2,2-dimethylcyclopentylidene)-2-fluoroacetic acid
SMILESCC1(C)CCCC1=C(F)C(=O)O
InChIInChI=1S/C9H13FO2/c1-9(2)5-3-4-6(9)7(10)8(11)12/h3-5H2,1-2H3,(H,11,12)
InChIKeyYITKVPRTLBFCEL-UHFFFAOYSA-N
MW172.20 g/mol
LogP2.50
Rot. Bonds1

About 2-(2,2-dimethylcyclopentylidene)-2-fluoroacetic acid

2-(2,2-dimethylcyclopentylidene)-2-fluoroacetic acid (PubChem CID 79856610) has the molecular formula C9H13FO2 and a molecular weight of 172.20 g/mol. Its IUPAC name is 2-(2,2-dimethylcyclopentylidene)-2-fluoroacetic acid.

Molecular Properties

Compound Name2-(2,2-dimethylcyclopentylidene)-2-fluoroacetic acid
PubChem CID79856610
Molecular FormulaC9H13FO2
Molecular Weight172.20 g/mol
Exact Mass172.09
IUPAC Name2-(2,2-dimethylcyclopentylidene)-2-fluoroacetic acid
SMILESCC1(C)CCCC1=C(F)C(=O)O
InChIInChI=1S/C9H13FO2/c1-9(2)5-3-4-6(9)7(10)8(11)12/h3-5H2,1-2H3,(H,11,12)
InChIKeyYITKVPRTLBFCEL-UHFFFAOYSA-N
XLogP2.50
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds1
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500172.20
LogP ≤ 52.50
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 2-(2,2-dimethylcyclopentylidene)-2-fluoroacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2,2-dimethylcyclopentylidene)-2-fluoroacetic acid?
The IUPAC name of 2-(2,2-dimethylcyclopentylidene)-2-fluoroacetic acid (CID 79856610) is 2-(2,2-dimethylcyclopentylidene)-2-fluoroacetic acid.
What is the SMILES notation for 2-(2,2-dimethylcyclopentylidene)-2-fluoroacetic acid?
The canonical SMILES for 2-(2,2-dimethylcyclopentylidene)-2-fluoroacetic acid is CC1(C)CCCC1=C(F)C(=O)O.
What is the InChIKey of 2-(2,2-dimethylcyclopentylidene)-2-fluoroacetic acid?
The InChIKey is YITKVPRTLBFCEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13FO2/c1-9(2)5-3-4-6(9)7(10)8(11)12/h3-5H2,1-2H3,(H,11,12).
What are the key properties of 2-(2,2-dimethylcyclopentylidene)-2-fluoroacetic acid?
2-(2,2-dimethylcyclopentylidene)-2-fluoroacetic acid has a molecular weight of 172.20 g/mol, XLogP of 2.50, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,2-dimethylcyclopentylidene)-2-fluoroacetic acid is sourced from PubChem (CID 79856610), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).