C8H20N2O3S — CID 79858152
2-amino-2-methyl-3-[methyl(2-methylsulfonylethyl)amino]propan-1-ol (PubChem CID 79858152) has the molecular formula C8H20N2O3S and a molecular weight of 224.33 g/mol. Its IUPAC name is 2-amino-2-methyl-3-[methyl(2-methylsulfonylethyl)amino]propan-1-ol.
| Compound Name | 2-amino-2-methyl-3-[methyl(2-methylsulfonylethyl)amino]propan-1-ol |
|---|---|
| PubChem CID | 79858152 |
| Molecular Formula | C8H20N2O3S |
| Molecular Weight | 224.33 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | 2-amino-2-methyl-3-[methyl(2-methylsulfonylethyl)amino]propan-1-ol |
| SMILES | CN(CCS(C)(=O)=O)CC(C)(N)CO |
| InChI | InChI=1S/C8H20N2O3S/c1-8(9,7-11)6-10(2)4-5-14(3,12)13/h11H,4-7,9H2,1-3H3 |
| InChIKey | KCCASZGKVKBZIQ-UHFFFAOYSA-N |
| XLogP | -1.33 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.33 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |