C13H28N2O2S — CID 79858645
N-methyl-1-[2-[methyl(2-methylsulfonylethyl)amino]ethyl]cyclohexan-1-amine (PubChem CID 79858645) has the molecular formula C13H28N2O2S and a molecular weight of 276.45 g/mol. Its IUPAC name is N-methyl-1-[2-[methyl(2-methylsulfonylethyl)amino]ethyl]cyclohexan-1-amine.
| Compound Name | N-methyl-1-[2-[methyl(2-methylsulfonylethyl)amino]ethyl]cyclohexan-1-amine |
|---|---|
| PubChem CID | 79858645 |
| Molecular Formula | C13H28N2O2S |
| Molecular Weight | 276.45 g/mol |
| Exact Mass | 276.19 |
| IUPAC Name | N-methyl-1-[2-[methyl(2-methylsulfonylethyl)amino]ethyl]cyclohexan-1-amine |
| SMILES | CNC1(CCN(C)CCS(C)(=O)=O)CCCCC1 |
| InChI | InChI=1S/C13H28N2O2S/c1-14-13(7-5-4-6-8-13)9-10-15(2)11-12-18(3,16)17/h14H,4-12H2,1-3H3 |
| InChIKey | IBTLPUHSXUJXQJ-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.45 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |