C13H26N2O4S — CID 79858651
methyl 1-amino-2-[2-[methyl(2-methylsulfonylethyl)amino]ethyl]cyclopentane-1-carboxylate (PubChem CID 79858651) has the molecular formula C13H26N2O4S and a molecular weight of 306.43 g/mol. Its IUPAC name is methyl 1-amino-2-[2-[methyl(2-methylsulfonylethyl)amino]ethyl]cyclopentane-1-carboxylate.
| Compound Name | methyl 1-amino-2-[2-[methyl(2-methylsulfonylethyl)amino]ethyl]cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 79858651 |
| Molecular Formula | C13H26N2O4S |
| Molecular Weight | 306.43 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | methyl 1-amino-2-[2-[methyl(2-methylsulfonylethyl)amino]ethyl]cyclopentane-1-carboxylate |
| SMILES | COC(=O)C1(N)CCCC1CCN(C)CCS(C)(=O)=O |
| InChI | InChI=1S/C13H26N2O4S/c1-15(9-10-20(3,17)18)8-6-11-5-4-7-13(11,14)12(16)19-2/h11H,4-10,14H2,1-3H3 |
| InChIKey | YZBPPKWETSPHTQ-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.43 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |