C15H30N2O3S — CID 79844792
[1-(cyclopropylamino)-2-[2-[methyl(2-methylsulfonylethyl)amino]ethyl]cyclopentyl]methanol (PubChem CID 79844792) has the molecular formula C15H30N2O3S and a molecular weight of 318.48 g/mol. Its IUPAC name is [1-(cyclopropylamino)-2-[2-[methyl(2-methylsulfonylethyl)amino]ethyl]cyclopentyl]methanol.
| Compound Name | [1-(cyclopropylamino)-2-[2-[methyl(2-methylsulfonylethyl)amino]ethyl]cyclopentyl]methanol |
|---|---|
| PubChem CID | 79844792 |
| Molecular Formula | C15H30N2O3S |
| Molecular Weight | 318.48 g/mol |
| Exact Mass | 318.20 |
| IUPAC Name | [1-(cyclopropylamino)-2-[2-[methyl(2-methylsulfonylethyl)amino]ethyl]cyclopentyl]methanol |
| SMILES | CN(CCC1CCCC1(CO)NC1CC1)CCS(C)(=O)=O |
| InChI | InChI=1S/C15H30N2O3S/c1-17(10-11-21(2,19)20)9-7-13-4-3-8-15(13,12-18)16-14-5-6-14/h13-14,16,18H,3-12H2,1-2H3 |
| InChIKey | JRODHDYDUFAAGL-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.48 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |