C9H11NOS — CID 79863157
4,4-dimethyl-5,6-dihydrocyclopenta[d][1,3]thiazole-2-carbaldehyde (PubChem CID 79863157) has the molecular formula C9H11NOS and a molecular weight of 181.26 g/mol. Its IUPAC name is 4,4-dimethyl-5,6-dihydrocyclopenta[d][1,3]thiazole-2-carbaldehyde.
| Compound Name | 4,4-dimethyl-5,6-dihydrocyclopenta[d][1,3]thiazole-2-carbaldehyde |
|---|---|
| PubChem CID | 79863157 |
| Molecular Formula | C9H11NOS |
| Molecular Weight | 181.26 g/mol |
| Exact Mass | 181.06 |
| IUPAC Name | 4,4-dimethyl-5,6-dihydrocyclopenta[d][1,3]thiazole-2-carbaldehyde |
| SMILES | CC1(C)CCc2sc(C=O)nc21 |
| InChI | InChI=1S/C9H11NOS/c1-9(2)4-3-6-8(9)10-7(5-11)12-6/h5H,3-4H2,1-2H3 |
| InChIKey | KZZGPHLOPPCSQN-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.26 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|