C14H20BrN — CID 79864735
2-bromo-N-(2,2-dimethylcyclopentyl)-4-methylaniline (PubChem CID 79864735) has the molecular formula C14H20BrN and a molecular weight of 282.22 g/mol. Its IUPAC name is 2-bromo-N-(2,2-dimethylcyclopentyl)-4-methylaniline.
| Compound Name | 2-bromo-N-(2,2-dimethylcyclopentyl)-4-methylaniline |
|---|---|
| PubChem CID | 79864735 |
| Molecular Formula | C14H20BrN |
| Molecular Weight | 282.22 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | 2-bromo-N-(2,2-dimethylcyclopentyl)-4-methylaniline |
| SMILES | Cc1ccc(NC2CCCC2(C)C)c(Br)c1 |
| InChI | InChI=1S/C14H20BrN/c1-10-6-7-12(11(15)9-10)16-13-5-4-8-14(13,2)3/h6-7,9,13,16H,4-5,8H2,1-3H3 |
| InChIKey | NAMRLFJYXXVVPK-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.22 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |