About 4-bromo-N-methyl-N-(2-methylsulfonylethyl)-1,3-thiazol-2-amine
4-bromo-N-methyl-N-(2-methylsulfonylethyl)-1,3-thiazol-2-amine (PubChem CID 79864884) has the molecular formula C7H11BrN2O2S2
and a molecular weight of 299.22 g/mol. Its IUPAC name is 4-bromo-N-methyl-N-(2-methylsulfonylethyl)-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | 4-bromo-N-methyl-N-(2-methylsulfonylethyl)-1,3-thiazol-2-amine |
| PubChem CID | 79864884 |
| Molecular Formula | C7H11BrN2O2S2 |
| Molecular Weight | 299.22 g/mol |
| Exact Mass | 297.94 |
| IUPAC Name | 4-bromo-N-methyl-N-(2-methylsulfonylethyl)-1,3-thiazol-2-amine |
| SMILES | CN(CCS(C)(=O)=O)c1nc(Br)cs1 |
| InChI | InChI=1S/C7H11BrN2O2S2/c1-10(3-4-14(2,11)12)7-9-6(8)5-13-7/h5H,3-4H2,1-2H3 |
| InChIKey | CJXIRDDFVXKBRD-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.22 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-bromo-N-methyl-N-(2-methylsulfonylethyl)-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-N-methyl-N-(2-methylsulfonylethyl)-1,3-thiazol-2-amine?
The IUPAC name of 4-bromo-N-methyl-N-(2-methylsulfonylethyl)-1,3-thiazol-2-amine (CID 79864884) is 4-bromo-N-methyl-N-(2-methylsulfonylethyl)-1,3-thiazol-2-amine.
What is the SMILES notation for 4-bromo-N-methyl-N-(2-methylsulfonylethyl)-1,3-thiazol-2-amine?
The canonical SMILES for 4-bromo-N-methyl-N-(2-methylsulfonylethyl)-1,3-thiazol-2-amine is CN(CCS(C)(=O)=O)c1nc(Br)cs1.
What is the InChIKey of 4-bromo-N-methyl-N-(2-methylsulfonylethyl)-1,3-thiazol-2-amine?
The InChIKey is CJXIRDDFVXKBRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11BrN2O2S2/c1-10(3-4-14(2,11)12)7-9-6(8)5-13-7/h5H,3-4H2,1-2H3.
What are the key properties of 4-bromo-N-methyl-N-(2-methylsulfonylethyl)-1,3-thiazol-2-amine?
4-bromo-N-methyl-N-(2-methylsulfonylethyl)-1,3-thiazol-2-amine has a molecular weight of 299.22 g/mol, XLogP of 1.39, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-N-methyl-N-(2-methylsulfonylethyl)-1,3-thiazol-2-amine is sourced from PubChem (CID 79864884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).