C12H17NO6 — CID 79869298
2-[6-(hydroxymethyl)-4-oxopyran-3-yl]oxy-N-(2-methoxyethyl)propanamide (PubChem CID 79869298) has the molecular formula C12H17NO6 and a molecular weight of 271.27 g/mol. Its IUPAC name is 2-[6-(hydroxymethyl)-4-oxopyran-3-yl]oxy-N-(2-methoxyethyl)propanamide.
| Compound Name | 2-[6-(hydroxymethyl)-4-oxopyran-3-yl]oxy-N-(2-methoxyethyl)propanamide |
|---|---|
| PubChem CID | 79869298 |
| Molecular Formula | C12H17NO6 |
| Molecular Weight | 271.27 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | 2-[6-(hydroxymethyl)-4-oxopyran-3-yl]oxy-N-(2-methoxyethyl)propanamide |
| SMILES | COCCNC(=O)C(C)Oc1coc(CO)cc1=O |
| InChI | InChI=1S/C12H17NO6/c1-8(12(16)13-3-4-17-2)19-11-7-18-9(6-14)5-10(11)15/h5,7-8,14H,3-4,6H2,1-2H3,(H,13,16) |
| InChIKey | UQDBKEQHZAKYPB-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 98.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.27 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|