C19H21F3N2O4 — CID 7986968
ethyl (2S)-4-morpholin-4-yl-6-oxo-2-phenyl-2-(trifluoromethyl)-1,3-dihydropyridine-5-carboxylate (PubChem CID 7986968) has the molecular formula C19H21F3N2O4 and a molecular weight of 398.38 g/mol. Its IUPAC name is ethyl (2S)-4-morpholin-4-yl-6-oxo-2-phenyl-2-(trifluoromethyl)-1,3-dihydropyridine-5-carboxylate.
| Compound Name | ethyl (2S)-4-morpholin-4-yl-6-oxo-2-phenyl-2-(trifluoromethyl)-1,3-dihydropyridine-5-carboxylate |
|---|---|
| PubChem CID | 7986968 |
| Molecular Formula | C19H21F3N2O4 |
| Molecular Weight | 398.38 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | ethyl (2S)-4-morpholin-4-yl-6-oxo-2-phenyl-2-(trifluoromethyl)-1,3-dihydropyridine-5-carboxylate |
| SMILES | CCOC(=O)C1=C(N2CCOCC2)C[C@](c2ccccc2)(C(F)(F)F)NC1=O |
| InChI | InChI=1S/C19H21F3N2O4/c1-2-28-17(26)15-14(24-8-10-27-11-9-24)12-18(19(20,21)22,23-16(15)25)13-6-4-3-5-7-13/h3-7H,2,8-12H2,1H3,(H,23,25)/t18-/m0/s1 |
| InChIKey | JUHIZFPZTKIVKH-SFHVURJKSA-N |
| XLogP | 2.11 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.38 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|