C12H21NO — CID 79871529
1-(2,2-dimethylcyclohexyl)pyrrolidin-3-one (PubChem CID 79871529) has the molecular formula C12H21NO and a molecular weight of 195.31 g/mol. Its IUPAC name is 1-(2,2-dimethylcyclohexyl)pyrrolidin-3-one.
| Compound Name | 1-(2,2-dimethylcyclohexyl)pyrrolidin-3-one |
|---|---|
| PubChem CID | 79871529 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | 1-(2,2-dimethylcyclohexyl)pyrrolidin-3-one |
| SMILES | CC1(C)CCCCC1N1CCC(=O)C1 |
| InChI | InChI=1S/C12H21NO/c1-12(2)7-4-3-5-11(12)13-8-6-10(14)9-13/h11H,3-9H2,1-2H3 |
| InChIKey | ALJLGVUKZBCPIH-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |