C9H16ClNO — CID 79872044
2-chloro-N-(2,2-dimethylcyclopentyl)acetamide (PubChem CID 79872044) has the molecular formula C9H16ClNO and a molecular weight of 189.69 g/mol. Its IUPAC name is 2-chloro-N-(2,2-dimethylcyclopentyl)acetamide.
| Compound Name | 2-chloro-N-(2,2-dimethylcyclopentyl)acetamide |
|---|---|
| PubChem CID | 79872044 |
| Molecular Formula | C9H16ClNO |
| Molecular Weight | 189.69 g/mol |
| Exact Mass | 189.09 |
| IUPAC Name | 2-chloro-N-(2,2-dimethylcyclopentyl)acetamide |
| SMILES | CC1(C)CCCC1NC(=O)CCl |
| InChI | InChI=1S/C9H16ClNO/c1-9(2)5-3-4-7(9)11-8(12)6-10/h7H,3-6H2,1-2H3,(H,11,12) |
| InChIKey | YTUMGHPBKSWGHN-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.69 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|