C12H22ClNO — CID 79871536
3-chloro-N-(2,2-dimethylcyclopentyl)-2,2-dimethylpropanamide (PubChem CID 79871536) has the molecular formula C12H22ClNO and a molecular weight of 231.77 g/mol. Its IUPAC name is 3-chloro-N-(2,2-dimethylcyclopentyl)-2,2-dimethylpropanamide.
| Compound Name | 3-chloro-N-(2,2-dimethylcyclopentyl)-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 79871536 |
| Molecular Formula | C12H22ClNO |
| Molecular Weight | 231.77 g/mol |
| Exact Mass | 231.14 |
| IUPAC Name | 3-chloro-N-(2,2-dimethylcyclopentyl)-2,2-dimethylpropanamide |
| SMILES | CC(C)(CCl)C(=O)NC1CCCC1(C)C |
| InChI | InChI=1S/C12H22ClNO/c1-11(2)7-5-6-9(11)14-10(15)12(3,4)8-13/h9H,5-8H2,1-4H3,(H,14,15) |
| InChIKey | JXHCQNQSVVGXFG-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.77 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|