About 3-[(2,2-dimethylcyclopentyl)amino]-2,2-dimethylpropanoic acid
3-[(2,2-dimethylcyclopentyl)amino]-2,2-dimethylpropanoic acid (PubChem CID 79870141) has the molecular formula C12H23NO2
and a molecular weight of 213.32 g/mol. Its IUPAC name is 3-[(2,2-dimethylcyclopentyl)amino]-2,2-dimethylpropanoic acid.
Analyze 3-[(2,2-dimethylcyclopentyl)amino]-2,2-dimethylpropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2,2-dimethylcyclopentyl)amino]-2,2-dimethylpropanoic acid?
The IUPAC name of 3-[(2,2-dimethylcyclopentyl)amino]-2,2-dimethylpropanoic acid (CID 79870141) is 3-[(2,2-dimethylcyclopentyl)amino]-2,2-dimethylpropanoic acid.
What is the SMILES notation for 3-[(2,2-dimethylcyclopentyl)amino]-2,2-dimethylpropanoic acid?
The canonical SMILES for 3-[(2,2-dimethylcyclopentyl)amino]-2,2-dimethylpropanoic acid is CC(C)(CNC1CCCC1(C)C)C(=O)O.
What is the InChIKey of 3-[(2,2-dimethylcyclopentyl)amino]-2,2-dimethylpropanoic acid?
The InChIKey is FJBHCUVGSCOSRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23NO2/c1-11(2)7-5-6-9(11)13-8-12(3,4)10(14)15/h9,13H,5-8H2,1-4H3,(H,14,15).
What are the key properties of 3-[(2,2-dimethylcyclopentyl)amino]-2,2-dimethylpropanoic acid?
3-[(2,2-dimethylcyclopentyl)amino]-2,2-dimethylpropanoic acid has a molecular weight of 213.32 g/mol, XLogP of 2.27, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2,2-dimethylcyclopentyl)amino]-2,2-dimethylpropanoic acid is sourced from PubChem (CID 79870141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).