C13H16N2O4S2 — CID 79872223
2-[2-(4,4-dimethyl-1,1,3-trioxothiazetidin-2-yl)ethoxy]benzenecarbothioamide (PubChem CID 79872223) has the molecular formula C13H16N2O4S2 and a molecular weight of 328.42 g/mol. Its IUPAC name is 2-[2-(4,4-dimethyl-1,1,3-trioxothiazetidin-2-yl)ethoxy]benzenecarbothioamide.
| Compound Name | 2-[2-(4,4-dimethyl-1,1,3-trioxothiazetidin-2-yl)ethoxy]benzenecarbothioamide |
|---|---|
| PubChem CID | 79872223 |
| Molecular Formula | C13H16N2O4S2 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.06 |
| IUPAC Name | 2-[2-(4,4-dimethyl-1,1,3-trioxothiazetidin-2-yl)ethoxy]benzenecarbothioamide |
| SMILES | CC1(C)C(=O)N(CCOc2ccccc2C(N)=S)S1(=O)=O |
| InChI | InChI=1S/C13H16N2O4S2/c1-13(2)12(16)15(21(13,17)18)7-8-19-10-6-4-3-5-9(10)11(14)20/h3-6H,7-8H2,1-2H3,(H2,14,20) |
| InChIKey | ZUBHSQHEBIMYEV-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|