C11H10N2O3S — CID 79875276
3-(4,4-dimethyl-1,1,3-trioxothiazetidin-2-yl)benzonitrile (PubChem CID 79875276) has the molecular formula C11H10N2O3S and a molecular weight of 250.28 g/mol. Its IUPAC name is 3-(4,4-dimethyl-1,1,3-trioxothiazetidin-2-yl)benzonitrile.
| Compound Name | 3-(4,4-dimethyl-1,1,3-trioxothiazetidin-2-yl)benzonitrile |
|---|---|
| PubChem CID | 79875276 |
| Molecular Formula | C11H10N2O3S |
| Molecular Weight | 250.28 g/mol |
| Exact Mass | 250.04 |
| IUPAC Name | 3-(4,4-dimethyl-1,1,3-trioxothiazetidin-2-yl)benzonitrile |
| SMILES | CC1(C)C(=O)N(c2cccc(C#N)c2)S1(=O)=O |
| InChI | InChI=1S/C11H10N2O3S/c1-11(2)10(14)13(17(11,15)16)9-5-3-4-8(6-9)7-12/h3-6H,1-2H3 |
| InChIKey | WFFGAWSZCULTEK-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 78.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.28 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |