C14H12F3N3S — CID 79875370
2-(4-methylphenyl)sulfanyl-6-(trifluoromethyl)pyridine-3-carboximidamide (PubChem CID 79875370) has the molecular formula C14H12F3N3S and a molecular weight of 311.33 g/mol. Its IUPAC name is 2-(4-methylphenyl)sulfanyl-6-(trifluoromethyl)pyridine-3-carboximidamide.
| Compound Name | 2-(4-methylphenyl)sulfanyl-6-(trifluoromethyl)pyridine-3-carboximidamide |
|---|---|
| PubChem CID | 79875370 |
| Molecular Formula | C14H12F3N3S |
| Molecular Weight | 311.33 g/mol |
| Exact Mass | 311.07 |
| IUPAC Name | 2-(4-methylphenyl)sulfanyl-6-(trifluoromethyl)pyridine-3-carboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(C(F)(F)F)nc1Sc1ccc(C)cc1 |
| InChI | InChI=1S/C14H12F3N3S/c1-8-2-4-9(5-3-8)21-13-10(12(18)19)6-7-11(20-13)14(15,16)17/h2-7H,1H3,(H3,18,19) |
| InChIKey | BWUAZDYXEXKKBW-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 62.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.33 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|