3-(4,4-dimethyl-1,1,3-trioxothiazetidin-2-yl)propanoic acid

C7H11NO5S — CID 79875450

IUPAC3-(4,4-dimethyl-1,1,3-trioxothiazetidin-2-yl)propanoic acid
SMILESCC1(C)C(=O)N(CCC(=O)O)S1(=O)=O
InChIInChI=1S/C7H11NO5S/c1-7(2)6(11)8(14(7,12)13)4-3-5(9)10/h3-4H2,1-2H3,(H,9,10)
InChIKeyHDZCYUNTEPVYMM-UHFFFAOYSA-N
MW221.23 g/mol
LogP-0.59
Rot. Bonds3

About 3-(4,4-dimethyl-1,1,3-trioxothiazetidin-2-yl)propanoic acid

3-(4,4-dimethyl-1,1,3-trioxothiazetidin-2-yl)propanoic acid (PubChem CID 79875450) has the molecular formula C7H11NO5S and a molecular weight of 221.23 g/mol. Its IUPAC name is 3-(4,4-dimethyl-1,1,3-trioxothiazetidin-2-yl)propanoic acid.

Molecular Properties

Compound Name3-(4,4-dimethyl-1,1,3-trioxothiazetidin-2-yl)propanoic acid
PubChem CID79875450
Molecular FormulaC7H11NO5S
Molecular Weight221.23 g/mol
Exact Mass221.04
IUPAC Name3-(4,4-dimethyl-1,1,3-trioxothiazetidin-2-yl)propanoic acid
SMILESCC1(C)C(=O)N(CCC(=O)O)S1(=O)=O
InChIInChI=1S/C7H11NO5S/c1-7(2)6(11)8(14(7,12)13)4-3-5(9)10/h3-4H2,1-2H3,(H,9,10)
InChIKeyHDZCYUNTEPVYMM-UHFFFAOYSA-N
XLogP-0.59
TPSA91.75 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500221.23
LogP ≤ 5-0.59
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 3-(4,4-dimethyl-1,1,3-trioxothiazetidin-2-yl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(4,4-dimethyl-1,1,3-trioxothiazetidin-2-yl)propanoic acid?
The IUPAC name of 3-(4,4-dimethyl-1,1,3-trioxothiazetidin-2-yl)propanoic acid (CID 79875450) is 3-(4,4-dimethyl-1,1,3-trioxothiazetidin-2-yl)propanoic acid.
What is the SMILES notation for 3-(4,4-dimethyl-1,1,3-trioxothiazetidin-2-yl)propanoic acid?
The canonical SMILES for 3-(4,4-dimethyl-1,1,3-trioxothiazetidin-2-yl)propanoic acid is CC1(C)C(=O)N(CCC(=O)O)S1(=O)=O.
What is the InChIKey of 3-(4,4-dimethyl-1,1,3-trioxothiazetidin-2-yl)propanoic acid?
The InChIKey is HDZCYUNTEPVYMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO5S/c1-7(2)6(11)8(14(7,12)13)4-3-5(9)10/h3-4H2,1-2H3,(H,9,10).
What are the key properties of 3-(4,4-dimethyl-1,1,3-trioxothiazetidin-2-yl)propanoic acid?
3-(4,4-dimethyl-1,1,3-trioxothiazetidin-2-yl)propanoic acid has a molecular weight of 221.23 g/mol, XLogP of -0.59, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4,4-dimethyl-1,1,3-trioxothiazetidin-2-yl)propanoic acid is sourced from PubChem (CID 79875450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).