C12H20N2O3S2 — CID 79875974
1-(4,4-dimethyl-1,1,3-trioxothiazetidin-2-yl)-4-methylcyclohexane-1-carbothioamide (PubChem CID 79875974) has the molecular formula C12H20N2O3S2 and a molecular weight of 304.44 g/mol. Its IUPAC name is 1-(4,4-dimethyl-1,1,3-trioxothiazetidin-2-yl)-4-methylcyclohexane-1-carbothioamide.
| Compound Name | 1-(4,4-dimethyl-1,1,3-trioxothiazetidin-2-yl)-4-methylcyclohexane-1-carbothioamide |
|---|---|
| PubChem CID | 79875974 |
| Molecular Formula | C12H20N2O3S2 |
| Molecular Weight | 304.44 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | 1-(4,4-dimethyl-1,1,3-trioxothiazetidin-2-yl)-4-methylcyclohexane-1-carbothioamide |
| SMILES | CC1CCC(C(N)=S)(N2C(=O)C(C)(C)S2(=O)=O)CC1 |
| InChI | InChI=1S/C12H20N2O3S2/c1-8-4-6-12(7-5-8,9(13)18)14-10(15)11(2,3)19(14,16)17/h8H,4-7H2,1-3H3,(H2,13,18) |
| InChIKey | ISHHLGGATXHSKO-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.44 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|