C15H29N3O — CID 79878300
2-(1,4-diazepan-1-yl)-N-(2,2-dimethylcyclohexyl)acetamide (PubChem CID 79878300) has the molecular formula C15H29N3O and a molecular weight of 267.42 g/mol. Its IUPAC name is 2-(1,4-diazepan-1-yl)-N-(2,2-dimethylcyclohexyl)acetamide.
| Compound Name | 2-(1,4-diazepan-1-yl)-N-(2,2-dimethylcyclohexyl)acetamide |
|---|---|
| PubChem CID | 79878300 |
| Molecular Formula | C15H29N3O |
| Molecular Weight | 267.42 g/mol |
| Exact Mass | 267.23 |
| IUPAC Name | 2-(1,4-diazepan-1-yl)-N-(2,2-dimethylcyclohexyl)acetamide |
| SMILES | CC1(C)CCCCC1NC(=O)CN1CCCNCC1 |
| InChI | InChI=1S/C15H29N3O/c1-15(2)7-4-3-6-13(15)17-14(19)12-18-10-5-8-16-9-11-18/h13,16H,3-12H2,1-2H3,(H,17,19) |
| InChIKey | JSMMFYPTWLNZNZ-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.42 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |