C13H24N4O2 — CID 62837563
2-(1,4-diazepan-1-yl)-N-(2-oxoazepan-3-yl)acetamide (PubChem CID 62837563) has the molecular formula C13H24N4O2 and a molecular weight of 268.36 g/mol. Its IUPAC name is 2-(1,4-diazepan-1-yl)-N-(2-oxoazepan-3-yl)acetamide.
| Compound Name | 2-(1,4-diazepan-1-yl)-N-(2-oxoazepan-3-yl)acetamide |
|---|---|
| PubChem CID | 62837563 |
| Molecular Formula | C13H24N4O2 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.19 |
| IUPAC Name | 2-(1,4-diazepan-1-yl)-N-(2-oxoazepan-3-yl)acetamide |
| SMILES | O=C(CN1CCCNCC1)NC1CCCCNC1=O |
| InChI | InChI=1S/C13H24N4O2/c18-12(10-17-8-3-5-14-7-9-17)16-11-4-1-2-6-15-13(11)19/h11,14H,1-10H2,(H,15,19)(H,16,18) |
| InChIKey | RDWNUKUCVOAYFA-UHFFFAOYSA-N |
| XLogP | -0.93 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |