C17H32N4O3 — CID 124840360
2-[(3R)-4-(2-ethoxyethyl)-3-methylpiperazin-1-yl]-N-[(3R)-2-oxoazepan-3-yl]acetamide (PubChem CID 124840360) has the molecular formula C17H32N4O3 and a molecular weight of 340.47 g/mol. Its IUPAC name is 2-[(3R)-4-(2-ethoxyethyl)-3-methylpiperazin-1-yl]-N-[(3R)-2-oxoazepan-3-yl]acetamide.
| Compound Name | 2-[(3R)-4-(2-ethoxyethyl)-3-methylpiperazin-1-yl]-N-[(3R)-2-oxoazepan-3-yl]acetamide |
|---|---|
| PubChem CID | 124840360 |
| Molecular Formula | C17H32N4O3 |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.25 |
| IUPAC Name | 2-[(3R)-4-(2-ethoxyethyl)-3-methylpiperazin-1-yl]-N-[(3R)-2-oxoazepan-3-yl]acetamide |
| SMILES | CCOCCN1CCN(CC(=O)N[C@@H]2CCCCNC2=O)C[C@H]1C |
| InChI | InChI=1S/C17H32N4O3/c1-3-24-11-10-21-9-8-20(12-14(21)2)13-16(22)19-15-6-4-5-7-18-17(15)23/h14-15H,3-13H2,1-2H3,(H,18,23)(H,19,22)/t14-,15-/m1/s1 |
| InChIKey | YZSMGDHLTDNHNQ-HUUCEWRRSA-N |
| XLogP | -0.19 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|