C16H30N4O3 — CID 124840329
2-[(3R)-4-(2-methoxyethyl)-3-methylpiperazin-1-yl]-N-[(3S)-2-oxoazepan-3-yl]acetamide (PubChem CID 124840329) has the molecular formula C16H30N4O3 and a molecular weight of 326.44 g/mol. Its IUPAC name is 2-[(3R)-4-(2-methoxyethyl)-3-methylpiperazin-1-yl]-N-[(3S)-2-oxoazepan-3-yl]acetamide.
| Compound Name | 2-[(3R)-4-(2-methoxyethyl)-3-methylpiperazin-1-yl]-N-[(3S)-2-oxoazepan-3-yl]acetamide |
|---|---|
| PubChem CID | 124840329 |
| Molecular Formula | C16H30N4O3 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.23 |
| IUPAC Name | 2-[(3R)-4-(2-methoxyethyl)-3-methylpiperazin-1-yl]-N-[(3S)-2-oxoazepan-3-yl]acetamide |
| SMILES | COCCN1CCN(CC(=O)N[C@H]2CCCCNC2=O)C[C@H]1C |
| InChI | InChI=1S/C16H30N4O3/c1-13-11-19(7-8-20(13)9-10-23-2)12-15(21)18-14-5-3-4-6-17-16(14)22/h13-14H,3-12H2,1-2H3,(H,17,22)(H,18,21)/t13-,14+/m1/s1 |
| InChIKey | XLQUOSCIKLTMSA-KGLIPLIRSA-N |
| XLogP | -0.58 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |