C17H31N5O2 — CID 124813298
2-[(3R)-4-(2-ethoxyethyl)-3-methylpiperazin-1-yl]-N-(1,3,5-trimethylpyrazol-4-yl)acetamide (PubChem CID 124813298) has the molecular formula C17H31N5O2 and a molecular weight of 337.47 g/mol. Its IUPAC name is 2-[(3R)-4-(2-ethoxyethyl)-3-methylpiperazin-1-yl]-N-(1,3,5-trimethylpyrazol-4-yl)acetamide.
| Compound Name | 2-[(3R)-4-(2-ethoxyethyl)-3-methylpiperazin-1-yl]-N-(1,3,5-trimethylpyrazol-4-yl)acetamide |
|---|---|
| PubChem CID | 124813298 |
| Molecular Formula | C17H31N5O2 |
| Molecular Weight | 337.47 g/mol |
| Exact Mass | 337.25 |
| IUPAC Name | 2-[(3R)-4-(2-ethoxyethyl)-3-methylpiperazin-1-yl]-N-(1,3,5-trimethylpyrazol-4-yl)acetamide |
| SMILES | CCOCCN1CCN(CC(=O)Nc2c(C)nn(C)c2C)C[C@H]1C |
| InChI | InChI=1S/C17H31N5O2/c1-6-24-10-9-22-8-7-21(11-13(22)2)12-16(23)18-17-14(3)19-20(5)15(17)4/h13H,6-12H2,1-5H3,(H,18,23)/t13-/m1/s1 |
| InChIKey | ZJGYWSNPIFFDTR-CYBMUJFWSA-N |
| XLogP | 1.02 |
| TPSA | 62.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.47 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|