C16H22BrNO — CID 79878594
3-bromo-N-(2,2-dimethylcyclohexyl)-2-methylbenzamide (PubChem CID 79878594) has the molecular formula C16H22BrNO and a molecular weight of 324.26 g/mol. Its IUPAC name is 3-bromo-N-(2,2-dimethylcyclohexyl)-2-methylbenzamide.
| Compound Name | 3-bromo-N-(2,2-dimethylcyclohexyl)-2-methylbenzamide |
|---|---|
| PubChem CID | 79878594 |
| Molecular Formula | C16H22BrNO |
| Molecular Weight | 324.26 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | 3-bromo-N-(2,2-dimethylcyclohexyl)-2-methylbenzamide |
| SMILES | Cc1c(Br)cccc1C(=O)NC1CCCCC1(C)C |
| InChI | InChI=1S/C16H22BrNO/c1-11-12(7-6-8-13(11)17)15(19)18-14-9-4-5-10-16(14,2)3/h6-8,14H,4-5,9-10H2,1-3H3,(H,18,19) |
| InChIKey | QEAMSYXKRSDVKT-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.26 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |