About 3-bromo-2-methyl-N-(3-tricyclo[3.2.1.02,4]octanyl)benzamide
3-bromo-2-methyl-N-(3-tricyclo[3.2.1.02,4]octanyl)benzamide (PubChem CID 103767177) has the molecular formula C16H18BrNO
and a molecular weight of 320.23 g/mol. Its IUPAC name is 3-bromo-2-methyl-N-(3-tricyclo[3.2.1.02,4]octanyl)benzamide.
Molecular Properties
| Compound Name | 3-bromo-2-methyl-N-(3-tricyclo[3.2.1.02,4]octanyl)benzamide |
| PubChem CID | 103767177 |
| Molecular Formula | C16H18BrNO |
| Molecular Weight | 320.23 g/mol |
| Exact Mass | 319.06 |
| IUPAC Name | 3-bromo-2-methyl-N-(3-tricyclo[3.2.1.02,4]octanyl)benzamide |
| SMILES | Cc1c(Br)cccc1C(=O)NC1C2C3CCC(C3)C12 |
| InChI | InChI=1S/C16H18BrNO/c1-8-11(3-2-4-12(8)17)16(19)18-15-13-9-5-6-10(7-9)14(13)15/h2-4,9-10,13-15H,5-7H2,1H3,(H,18,19) |
| InChIKey | JDSNEAFGIUDJDZ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.23 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-bromo-2-methyl-N-(3-tricyclo[3.2.1.02,4]octanyl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-2-methyl-N-(3-tricyclo[3.2.1.02,4]octanyl)benzamide?
The IUPAC name of 3-bromo-2-methyl-N-(3-tricyclo[3.2.1.02,4]octanyl)benzamide (CID 103767177) is 3-bromo-2-methyl-N-(3-tricyclo[3.2.1.02,4]octanyl)benzamide.
What is the SMILES notation for 3-bromo-2-methyl-N-(3-tricyclo[3.2.1.02,4]octanyl)benzamide?
The canonical SMILES for 3-bromo-2-methyl-N-(3-tricyclo[3.2.1.02,4]octanyl)benzamide is Cc1c(Br)cccc1C(=O)NC1C2C3CCC(C3)C12.
What is the InChIKey of 3-bromo-2-methyl-N-(3-tricyclo[3.2.1.02,4]octanyl)benzamide?
The InChIKey is JDSNEAFGIUDJDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18BrNO/c1-8-11(3-2-4-12(8)17)16(19)18-15-13-9-5-6-10(7-9)14(13)15/h2-4,9-10,13-15H,5-7H2,1H3,(H,18,19).
What are the key properties of 3-bromo-2-methyl-N-(3-tricyclo[3.2.1.02,4]octanyl)benzamide?
3-bromo-2-methyl-N-(3-tricyclo[3.2.1.02,4]octanyl)benzamide has a molecular weight of 320.23 g/mol, XLogP of 3.53, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-2-methyl-N-(3-tricyclo[3.2.1.02,4]octanyl)benzamide is sourced from PubChem (CID 103767177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).