C13H19N3OS — CID 79881433
2-[2-(diethylamino)ethylsulfanyl]-1,3-benzoxazol-4-amine (PubChem CID 79881433) has the molecular formula C13H19N3OS and a molecular weight of 265.38 g/mol. Its IUPAC name is 2-[2-(diethylamino)ethylsulfanyl]-1,3-benzoxazol-4-amine.
| Compound Name | 2-[2-(diethylamino)ethylsulfanyl]-1,3-benzoxazol-4-amine |
|---|---|
| PubChem CID | 79881433 |
| Molecular Formula | C13H19N3OS |
| Molecular Weight | 265.38 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | 2-[2-(diethylamino)ethylsulfanyl]-1,3-benzoxazol-4-amine |
| SMILES | CCN(CC)CCSc1nc2c(N)cccc2o1 |
| InChI | InChI=1S/C13H19N3OS/c1-3-16(4-2)8-9-18-13-15-12-10(14)6-5-7-11(12)17-13/h5-7H,3-4,8-9,14H2,1-2H3 |
| InChIKey | ULWPZVDCYMMAFO-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 55.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.38 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|