C17H17N3O — CID 79881970
2-N-benzyl-2-N-cyclopropyl-1,3-benzoxazole-2,4-diamine (PubChem CID 79881970) has the molecular formula C17H17N3O and a molecular weight of 279.34 g/mol. Its IUPAC name is 2-N-benzyl-2-N-cyclopropyl-1,3-benzoxazole-2,4-diamine.
| Compound Name | 2-N-benzyl-2-N-cyclopropyl-1,3-benzoxazole-2,4-diamine |
|---|---|
| PubChem CID | 79881970 |
| Molecular Formula | C17H17N3O |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.14 |
| IUPAC Name | 2-N-benzyl-2-N-cyclopropyl-1,3-benzoxazole-2,4-diamine |
| SMILES | Nc1cccc2oc(N(Cc3ccccc3)C3CC3)nc12 |
| InChI | InChI=1S/C17H17N3O/c18-14-7-4-8-15-16(14)19-17(21-15)20(13-9-10-13)11-12-5-2-1-3-6-12/h1-8,13H,9-11,18H2 |
| InChIKey | PNNYAUJQGWBRPG-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 55.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|