C13H9ClF2N2O3 — CID 79882238
4-[(4-chloro-2-nitroanilino)methyl]-2,6-difluorophenol (PubChem CID 79882238) has the molecular formula C13H9ClF2N2O3 and a molecular weight of 314.68 g/mol. Its IUPAC name is 4-[(4-chloro-2-nitroanilino)methyl]-2,6-difluorophenol.
| Compound Name | 4-[(4-chloro-2-nitroanilino)methyl]-2,6-difluorophenol |
|---|---|
| PubChem CID | 79882238 |
| Molecular Formula | C13H9ClF2N2O3 |
| Molecular Weight | 314.68 g/mol |
| Exact Mass | 314.03 |
| IUPAC Name | 4-[(4-chloro-2-nitroanilino)methyl]-2,6-difluorophenol |
| SMILES | O=[N+]([O-])c1cc(Cl)ccc1NCc1cc(F)c(O)c(F)c1 |
| InChI | InChI=1S/C13H9ClF2N2O3/c14-8-1-2-11(12(5-8)18(20)21)17-6-7-3-9(15)13(19)10(16)4-7/h1-5,17,19H,6H2 |
| InChIKey | QICIGBRPTUZTRN-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 75.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.68 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|