5-amino-2-(2,6-dimethyl-4-oxo-1-pyridinyl)benzoic acid

C14H14N2O3 — CID 79885475

IUPAC5-amino-2-(2,6-dimethyl-4-oxo-1-pyridinyl)benzoic acid
SMILESCc1cc(=O)cc(C)n1-c1ccc(N)cc1C(=O)O
InChIInChI=1S/C14H14N2O3/c1-8-5-11(17)6-9(2)16(8)13-4-3-10(15)7-12(13)14(18)19/h3-7H,15H2,1-2H3,(H,18,19)
InChIKeyPBFILSUUECQPTO-UHFFFAOYSA-N
MW258.28 g/mol
LogP1.73
Rot. Bonds2

About 5-amino-2-(2,6-dimethyl-4-oxo-1-pyridinyl)benzoic acid

5-amino-2-(2,6-dimethyl-4-oxo-1-pyridinyl)benzoic acid (PubChem CID 79885475) has the molecular formula C14H14N2O3 and a molecular weight of 258.28 g/mol. Its IUPAC name is 5-amino-2-(2,6-dimethyl-4-oxo-1-pyridinyl)benzoic acid.

Molecular Properties

Compound Name5-amino-2-(2,6-dimethyl-4-oxo-1-pyridinyl)benzoic acid
PubChem CID79885475
Molecular FormulaC14H14N2O3
Molecular Weight258.28 g/mol
Exact Mass258.10
IUPAC Name5-amino-2-(2,6-dimethyl-4-oxo-1-pyridinyl)benzoic acid
SMILESCc1cc(=O)cc(C)n1-c1ccc(N)cc1C(=O)O
InChIInChI=1S/C14H14N2O3/c1-8-5-11(17)6-9(2)16(8)13-4-3-10(15)7-12(13)14(18)19/h3-7H,15H2,1-2H3,(H,18,19)
InChIKeyPBFILSUUECQPTO-UHFFFAOYSA-N
XLogP1.73
TPSA85.32 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500258.28
LogP ≤ 51.73
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aniline', 'substructure': 'N/A'}

Analyze 5-amino-2-(2,6-dimethyl-4-oxo-1-pyridinyl)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-amino-2-(2,6-dimethyl-4-oxo-1-pyridinyl)benzoic acid?
The IUPAC name of 5-amino-2-(2,6-dimethyl-4-oxo-1-pyridinyl)benzoic acid (CID 79885475) is 5-amino-2-(2,6-dimethyl-4-oxo-1-pyridinyl)benzoic acid.
What is the SMILES notation for 5-amino-2-(2,6-dimethyl-4-oxo-1-pyridinyl)benzoic acid?
The canonical SMILES for 5-amino-2-(2,6-dimethyl-4-oxo-1-pyridinyl)benzoic acid is Cc1cc(=O)cc(C)n1-c1ccc(N)cc1C(=O)O.
What is the InChIKey of 5-amino-2-(2,6-dimethyl-4-oxo-1-pyridinyl)benzoic acid?
The InChIKey is PBFILSUUECQPTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14N2O3/c1-8-5-11(17)6-9(2)16(8)13-4-3-10(15)7-12(13)14(18)19/h3-7H,15H2,1-2H3,(H,18,19).
What are the key properties of 5-amino-2-(2,6-dimethyl-4-oxo-1-pyridinyl)benzoic acid?
5-amino-2-(2,6-dimethyl-4-oxo-1-pyridinyl)benzoic acid has a molecular weight of 258.28 g/mol, XLogP of 1.73, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-2-(2,6-dimethyl-4-oxo-1-pyridinyl)benzoic acid is sourced from PubChem (CID 79885475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).