C14H14N2O3 — CID 79885475
5-amino-2-(2,6-dimethyl-4-oxo-1-pyridinyl)benzoic acid (PubChem CID 79885475) has the molecular formula C14H14N2O3 and a molecular weight of 258.28 g/mol. Its IUPAC name is 5-amino-2-(2,6-dimethyl-4-oxo-1-pyridinyl)benzoic acid.
| Compound Name | 5-amino-2-(2,6-dimethyl-4-oxo-1-pyridinyl)benzoic acid |
|---|---|
| PubChem CID | 79885475 |
| Molecular Formula | C14H14N2O3 |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | 5-amino-2-(2,6-dimethyl-4-oxo-1-pyridinyl)benzoic acid |
| SMILES | Cc1cc(=O)cc(C)n1-c1ccc(N)cc1C(=O)O |
| InChI | InChI=1S/C14H14N2O3/c1-8-5-11(17)6-9(2)16(8)13-4-3-10(15)7-12(13)14(18)19/h3-7H,15H2,1-2H3,(H,18,19) |
| InChIKey | PBFILSUUECQPTO-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 85.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|