C12H20N2O — CID 79885482
1-(1-aminopentan-2-yl)-2,6-dimethylpyridin-4-one (PubChem CID 79885482) has the molecular formula C12H20N2O and a molecular weight of 208.31 g/mol. Its IUPAC name is 1-(1-aminopentan-2-yl)-2,6-dimethylpyridin-4-one.
| Compound Name | 1-(1-aminopentan-2-yl)-2,6-dimethylpyridin-4-one |
|---|---|
| PubChem CID | 79885482 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.31 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | 1-(1-aminopentan-2-yl)-2,6-dimethylpyridin-4-one |
| SMILES | CCCC(CN)n1c(C)cc(=O)cc1C |
| InChI | InChI=1S/C12H20N2O/c1-4-5-11(8-13)14-9(2)6-12(15)7-10(14)3/h6-7,11H,4-5,8,13H2,1-3H3 |
| InChIKey | IWWNIGQEJNLUQT-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.31 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |