C13H14F2N2O2 — CID 79888570
[4-[(1-ethylimidazol-2-yl)methoxy]-3,5-difluorophenyl]methanol (PubChem CID 79888570) has the molecular formula C13H14F2N2O2 and a molecular weight of 268.26 g/mol. Its IUPAC name is [4-[(1-ethylimidazol-2-yl)methoxy]-3,5-difluorophenyl]methanol.
| Compound Name | [4-[(1-ethylimidazol-2-yl)methoxy]-3,5-difluorophenyl]methanol |
|---|---|
| PubChem CID | 79888570 |
| Molecular Formula | C13H14F2N2O2 |
| Molecular Weight | 268.26 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | [4-[(1-ethylimidazol-2-yl)methoxy]-3,5-difluorophenyl]methanol |
| SMILES | CCn1ccnc1COc1c(F)cc(CO)cc1F |
| InChI | InChI=1S/C13H14F2N2O2/c1-2-17-4-3-16-12(17)8-19-13-10(14)5-9(7-18)6-11(13)15/h3-6,18H,2,7-8H2,1H3 |
| InChIKey | OKCCYPJJNDUIKD-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.26 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |