C14H21NO2S — CID 79889051
N-[(2-cyclopropylphenyl)methyl]-3-methylsulfonylpropan-1-amine (PubChem CID 79889051) has the molecular formula C14H21NO2S and a molecular weight of 267.39 g/mol. Its IUPAC name is N-[(2-cyclopropylphenyl)methyl]-3-methylsulfonylpropan-1-amine.
| Compound Name | N-[(2-cyclopropylphenyl)methyl]-3-methylsulfonylpropan-1-amine |
|---|---|
| PubChem CID | 79889051 |
| Molecular Formula | C14H21NO2S |
| Molecular Weight | 267.39 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | N-[(2-cyclopropylphenyl)methyl]-3-methylsulfonylpropan-1-amine |
| SMILES | CS(=O)(=O)CCCNCc1ccccc1C1CC1 |
| InChI | InChI=1S/C14H21NO2S/c1-18(16,17)10-4-9-15-11-13-5-2-3-6-14(13)12-7-8-12/h2-3,5-6,12,15H,4,7-11H2,1H3 |
| InChIKey | SAYNTNIBJKATTD-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.39 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|