C17H18FN — CID 79889960
N-[(2-cyclopropylphenyl)methyl]-1-(4-fluorophenyl)methanamine (PubChem CID 79889960) has the molecular formula C17H18FN and a molecular weight of 255.34 g/mol. Its IUPAC name is N-[(2-cyclopropylphenyl)methyl]-1-(4-fluorophenyl)methanamine.
| Compound Name | N-[(2-cyclopropylphenyl)methyl]-1-(4-fluorophenyl)methanamine |
|---|---|
| PubChem CID | 79889960 |
| Molecular Formula | C17H18FN |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | N-[(2-cyclopropylphenyl)methyl]-1-(4-fluorophenyl)methanamine |
| SMILES | Fc1ccc(CNCc2ccccc2C2CC2)cc1 |
| InChI | InChI=1S/C17H18FN/c18-16-9-5-13(6-10-16)11-19-12-15-3-1-2-4-17(15)14-7-8-14/h1-6,9-10,14,19H,7-8,11-12H2 |
| InChIKey | ZUVZVDMNEXNEAN-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |