C15H21N3O — CID 79892463
2-N-(cyclohexylmethyl)-2-N-methyl-1,3-benzoxazole-2,6-diamine (PubChem CID 79892463) has the molecular formula C15H21N3O and a molecular weight of 259.35 g/mol. Its IUPAC name is 2-N-(cyclohexylmethyl)-2-N-methyl-1,3-benzoxazole-2,6-diamine.
| Compound Name | 2-N-(cyclohexylmethyl)-2-N-methyl-1,3-benzoxazole-2,6-diamine |
|---|---|
| PubChem CID | 79892463 |
| Molecular Formula | C15H21N3O |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.17 |
| IUPAC Name | 2-N-(cyclohexylmethyl)-2-N-methyl-1,3-benzoxazole-2,6-diamine |
| SMILES | CN(CC1CCCCC1)c1nc2ccc(N)cc2o1 |
| InChI | InChI=1S/C15H21N3O/c1-18(10-11-5-3-2-4-6-11)15-17-13-8-7-12(16)9-14(13)19-15/h7-9,11H,2-6,10,16H2,1H3 |
| InChIKey | AWYJPVDTXZQDHQ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 55.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|