C15H12N4O — CID 79893304
3-[(6-amino-1,3-benzoxazol-2-yl)-methylamino]benzonitrile (PubChem CID 79893304) has the molecular formula C15H12N4O and a molecular weight of 264.29 g/mol. Its IUPAC name is 3-[(6-amino-1,3-benzoxazol-2-yl)-methylamino]benzonitrile.
| Compound Name | 3-[(6-amino-1,3-benzoxazol-2-yl)-methylamino]benzonitrile |
|---|---|
| PubChem CID | 79893304 |
| Molecular Formula | C15H12N4O |
| Molecular Weight | 264.29 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | 3-[(6-amino-1,3-benzoxazol-2-yl)-methylamino]benzonitrile |
| SMILES | CN(c1cccc(C#N)c1)c1nc2ccc(N)cc2o1 |
| InChI | InChI=1S/C15H12N4O/c1-19(12-4-2-3-10(7-12)9-16)15-18-13-6-5-11(17)8-14(13)20-15/h2-8H,17H2,1H3 |
| InChIKey | IHBCCGUJTYNUSH-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 79.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.29 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|