C15H15N3O — CID 79893294
2-N-methyl-2-N-(3-methylphenyl)-1,3-benzoxazole-2,6-diamine (PubChem CID 79893294) has the molecular formula C15H15N3O and a molecular weight of 253.31 g/mol. Its IUPAC name is 2-N-methyl-2-N-(3-methylphenyl)-1,3-benzoxazole-2,6-diamine.
| Compound Name | 2-N-methyl-2-N-(3-methylphenyl)-1,3-benzoxazole-2,6-diamine |
|---|---|
| PubChem CID | 79893294 |
| Molecular Formula | C15H15N3O |
| Molecular Weight | 253.31 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | 2-N-methyl-2-N-(3-methylphenyl)-1,3-benzoxazole-2,6-diamine |
| SMILES | Cc1cccc(N(C)c2nc3ccc(N)cc3o2)c1 |
| InChI | InChI=1S/C15H15N3O/c1-10-4-3-5-12(8-10)18(2)15-17-13-7-6-11(16)9-14(13)19-15/h3-9H,16H2,1-2H3 |
| InChIKey | UFHWOGDVPXLSLZ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 55.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.31 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|