C9H16N2O3 — CID 79897297
3-[methyl-[2-oxo-2-(propylamino)ethyl]amino]prop-2-enoic acid (PubChem CID 79897297) has the molecular formula C9H16N2O3 and a molecular weight of 200.24 g/mol. Its IUPAC name is 3-[methyl-[2-oxo-2-(propylamino)ethyl]amino]prop-2-enoic acid.
| Compound Name | 3-[methyl-[2-oxo-2-(propylamino)ethyl]amino]prop-2-enoic acid |
|---|---|
| PubChem CID | 79897297 |
| Molecular Formula | C9H16N2O3 |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | 3-[methyl-[2-oxo-2-(propylamino)ethyl]amino]prop-2-enoic acid |
| SMILES | CCCNC(=O)CN(C)C=CC(=O)O |
| InChI | InChI=1S/C9H16N2O3/c1-3-5-10-8(12)7-11(2)6-4-9(13)14/h4,6H,3,5,7H2,1-2H3,(H,10,12)(H,13,14) |
| InChIKey | KZCNVIQLVNESFW-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|